About acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane
acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane (PubChem CID 143527879) has the molecular formula C17H22N4OS
and a molecular weight of 330.46 g/mol. Its IUPAC name is acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane.
Molecular Properties
| Compound Name | acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane |
| PubChem CID | 143527879 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane |
| SMILES | CC.CC=O.CNc1nc2ccc(-c3ccc(N)nc3)cc2s1 |
| InChI | InChI=1S/C13H12N4S.C2H4O.C2H6/c1-15-13-17-10-4-2-8(6-11(10)18-13)9-3-5-12(14)16-7-9;1-2-3;1-2/h2-7H,1H3,(H2,14,16)(H,15,17);2H,1H3;1-2H3 |
| InChIKey | JZDGCFZOBZTXKF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane?
The IUPAC name of acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane (CID 143527879) is acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane.
What is the SMILES notation for acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane?
The canonical SMILES for acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane is CC.CC=O.CNc1nc2ccc(-c3ccc(N)nc3)cc2s1.
What is the InChIKey of acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane?
The InChIKey is JZDGCFZOBZTXKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4S.C2H4O.C2H6/c1-15-13-17-10-4-2-8(6-11(10)18-13)9-3-5-12(14)16-7-9;1-2-3;1-2/h2-7H,1H3,(H2,14,16)(H,15,17);2H,1H3;1-2H3.
What are the key properties of acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane?
acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane has a molecular weight of 330.46 g/mol, XLogP of 4.21, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane is sourced from PubChem (CID 143527879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).