C17H22N4OS — CID 143527879
acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane (PubChem CID 143527879) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane.
| Compound Name | acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane |
|---|---|
| PubChem CID | 143527879 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | acetaldehyde;6-(6-amino-3-pyridinyl)-N-methyl-1,3-benzothiazol-2-amine;ethane |
| SMILES | CC.CC=O.CNc1nc2ccc(-c3ccc(N)nc3)cc2s1 |
| InChI | InChI=1S/C13H12N4S.C2H4O.C2H6/c1-15-13-17-10-4-2-8(6-11(10)18-13)9-3-5-12(14)16-7-9;1-2-3;1-2/h2-7H,1H3,(H2,14,16)(H,15,17);2H,1H3;1-2H3 |
| InChIKey | JZDGCFZOBZTXKF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|