C26H31NO4 — CID 143530558
4-[2-(4-methoxybenzoyl)-6-piperidin-1-ylhexanoyl]benzaldehyde (PubChem CID 143530558) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-[2-(4-methoxybenzoyl)-6-piperidin-1-ylhexanoyl]benzaldehyde.
| Compound Name | 4-[2-(4-methoxybenzoyl)-6-piperidin-1-ylhexanoyl]benzaldehyde |
|---|---|
| PubChem CID | 143530558 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 4-[2-(4-methoxybenzoyl)-6-piperidin-1-ylhexanoyl]benzaldehyde |
| SMILES | COc1ccc(C(=O)C(CCCCN2CCCCC2)C(=O)c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C26H31NO4/c1-31-23-14-12-22(13-15-23)26(30)24(7-3-6-18-27-16-4-2-5-17-27)25(29)21-10-8-20(19-28)9-11-21/h8-15,19,24H,2-7,16-18H2,1H3 |
| InChIKey | XGVZWTRFPRLRQI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|