C23H34FN3O2 — CID 143531863
1-[(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-2-[[(1R,3S)-3-[(E)-C-methyl-N-(3-phenylpropoxy)carbonimidoyl]cyclopentyl]amino]ethanone (PubChem CID 143531863) has the molecular formula C23H34FN3O2 and a molecular weight of 403.54 g/mol. Its IUPAC name is 1-[(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-2-[[(1R,3S)-3-[(E)-C-methyl-N-(3-phenylpropoxy)carbonimidoyl]cyclopentyl]amino]ethanone.
| Compound Name | 1-[(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-2-[[(1R,3S)-3-[(E)-C-methyl-N-(3-phenylpropoxy)carbonimidoyl]cyclopentyl]amino]ethanone |
|---|---|
| PubChem CID | 143531863 |
| Molecular Formula | C23H34FN3O2 |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 1-[(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-2-[[(1R,3S)-3-[(E)-C-methyl-N-(3-phenylpropoxy)carbonimidoyl]cyclopentyl]amino]ethanone |
| SMILES | C/C(=N\OCCCc1ccccc1)[C@H]1CC[C@@H](NCC(=O)N2C[C@@H](F)C[C@H]2C)C1 |
| InChI | InChI=1S/C23H34FN3O2/c1-17-13-21(24)16-27(17)23(28)15-25-22-11-10-20(14-22)18(2)26-29-12-6-9-19-7-4-3-5-8-19/h3-5,7-8,17,20-22,25H,6,9-16H2,1-2H3/b26-18+/t17-,20+,21+,22-/m1/s1 |
| InChIKey | ARXXYTOPWNPSDB-USMOOEMOSA-N |
| XLogP | 3.73 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|