C9H15FO — CID 143532131
(2E,4E)-3-ethoxy-4-fluorohepta-2,4-diene (PubChem CID 143532131) has the molecular formula C9H15FO and a molecular weight of 158.22 g/mol. Its IUPAC name is (2E,4E)-3-ethoxy-4-fluorohepta-2,4-diene.
| Compound Name | (2E,4E)-3-ethoxy-4-fluorohepta-2,4-diene |
|---|---|
| PubChem CID | 143532131 |
| Molecular Formula | C9H15FO |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (2E,4E)-3-ethoxy-4-fluorohepta-2,4-diene |
| SMILES | C/C=C(OCC)\C(F)=C/CC |
| InChI | InChI=1S/C9H15FO/c1-4-7-8(10)9(5-2)11-6-3/h5,7H,4,6H2,1-3H3/b8-7+,9-5+ |
| InChIKey | UWDAHVMASMMBIQ-DMQCZMPNSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|