C21H34 — CID 143532776
1,2,3,4,5-pentamethyl-6-[(E)-3-methylnon-2-enyl]benzene (PubChem CID 143532776) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-[(E)-3-methylnon-2-enyl]benzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-[(E)-3-methylnon-2-enyl]benzene |
|---|---|
| PubChem CID | 143532776 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-[(E)-3-methylnon-2-enyl]benzene |
| SMILES | CCCCCC/C(C)=C/Cc1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C21H34/c1-8-9-10-11-12-15(2)13-14-21-19(6)17(4)16(3)18(5)20(21)7/h13H,8-12,14H2,1-7H3/b15-13+ |
| InChIKey | PMYZSUSHUCYHOM-FYWRMAATSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|