C14H16F3N3O — CID 143533773
N,N-dimethyl-6-[(E)-5,5,5-trifluoro-4-methyliminopent-2-en-2-yl]pyridine-2-carboxamide (PubChem CID 143533773) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is N,N-dimethyl-6-[(E)-5,5,5-trifluoro-4-methyliminopent-2-en-2-yl]pyridine-2-carboxamide.
| Compound Name | N,N-dimethyl-6-[(E)-5,5,5-trifluoro-4-methyliminopent-2-en-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143533773 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N,N-dimethyl-6-[(E)-5,5,5-trifluoro-4-methyliminopent-2-en-2-yl]pyridine-2-carboxamide |
| SMILES | C/N=C(/C=C(\C)c1cccc(C(=O)N(C)C)n1)C(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O/c1-9(8-12(18-2)14(15,16)17)10-6-5-7-11(19-10)13(21)20(3)4/h5-8H,1-4H3/b9-8+,18-12- |
| InChIKey | FRWYFIJZQFFCQS-CGXKGLEISA-N |
| XLogP | 2.82 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|