C20H20F3N3S — CID 143533874
N-benzyl-N-ethyl-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]ethenamine (PubChem CID 143533874) has the molecular formula C20H20F3N3S and a molecular weight of 391.46 g/mol. Its IUPAC name is N-benzyl-N-ethyl-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]ethenamine.
| Compound Name | N-benzyl-N-ethyl-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]ethenamine |
|---|---|
| PubChem CID | 143533874 |
| Molecular Formula | C20H20F3N3S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-benzyl-N-ethyl-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]ethenamine |
| SMILES | C=C(c1ccc(-c2cc(C(F)(F)F)n(C)n2)s1)N(CC)Cc1ccccc1 |
| InChI | InChI=1S/C20H20F3N3S/c1-4-26(13-15-8-6-5-7-9-15)14(2)17-10-11-18(27-17)16-12-19(20(21,22)23)25(3)24-16/h5-12H,2,4,13H2,1,3H3 |
| InChIKey | OEIGYTHEYBDBTD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |