C22H28F2N2O5 — CID 143538950
N-(2,2-difluorobutyl)-5-methoxy-N-methyl-2-nitro-4-phenylmethoxybenzamide;ethane (PubChem CID 143538950) has the molecular formula C22H28F2N2O5 and a molecular weight of 438.47 g/mol. Its IUPAC name is N-(2,2-difluorobutyl)-5-methoxy-N-methyl-2-nitro-4-phenylmethoxybenzamide;ethane.
| Compound Name | N-(2,2-difluorobutyl)-5-methoxy-N-methyl-2-nitro-4-phenylmethoxybenzamide;ethane |
|---|---|
| PubChem CID | 143538950 |
| Molecular Formula | C22H28F2N2O5 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-(2,2-difluorobutyl)-5-methoxy-N-methyl-2-nitro-4-phenylmethoxybenzamide;ethane |
| SMILES | CC.CCC(F)(F)CN(C)C(=O)c1cc(OC)c(OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22F2N2O5.C2H6/c1-4-20(21,22)13-23(2)19(25)15-10-17(28-3)18(11-16(15)24(26)27)29-12-14-8-6-5-7-9-14;1-2/h5-11H,4,12-13H2,1-3H3;1-2H3 |
| InChIKey | KLFKDZLCLBIPEV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|