C17H23N5 — CID 143539232
N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide (PubChem CID 143539232) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide.
| Compound Name | N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide |
|---|---|
| PubChem CID | 143539232 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide |
| SMILES | CN(Cc1cc(C(C)(C)C#N)cc(C(C)(C)C#N)c1)/N=C\N |
| InChI | InChI=1S/C17H23N5/c1-16(2,10-18)14-6-13(9-22(5)21-12-20)7-15(8-14)17(3,4)11-19/h6-8,12H,9H2,1-5H3,(H2,20,21) |
| InChIKey | ZFOSTOIYAMFFJK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|