C20H25N5O2 — CID 142963238
ethyl 2-amino-2-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyliminomethylimino]acetate (PubChem CID 142963238) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethyl 2-amino-2-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyliminomethylimino]acetate.
| Compound Name | ethyl 2-amino-2-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyliminomethylimino]acetate |
|---|---|
| PubChem CID | 142963238 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | ethyl 2-amino-2-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyliminomethylimino]acetate |
| SMILES | CCOC(=O)/C(N)=N/C=N/Cc1cc(C(C)(C)C#N)cc(C(C)(C)C#N)c1 |
| InChI | InChI=1S/C20H25N5O2/c1-6-27-18(26)17(23)25-13-24-10-14-7-15(19(2,3)11-21)9-16(8-14)20(4,5)12-22/h7-9,13H,6,10H2,1-5H3,(H2,23,24,25) |
| InChIKey | KWBQBDFGGNQBGO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|