C17H18O — CID 143539694
1-[(3E,5E,7Z)-6-methoxynona-3,5,7-trien-1-ynyl]-4-methylbenzene (PubChem CID 143539694) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[(3E,5E,7Z)-6-methoxynona-3,5,7-trien-1-ynyl]-4-methylbenzene.
| Compound Name | 1-[(3E,5E,7Z)-6-methoxynona-3,5,7-trien-1-ynyl]-4-methylbenzene |
|---|---|
| PubChem CID | 143539694 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-[(3E,5E,7Z)-6-methoxynona-3,5,7-trien-1-ynyl]-4-methylbenzene |
| SMILES | C/C=C\C(=C/C=C/C#Cc1ccc(C)cc1)OC |
| InChI | InChI=1S/C17H18O/c1-4-8-17(18-3)10-7-5-6-9-16-13-11-15(2)12-14-16/h4-5,7-8,10-14H,1-3H3/b7-5+,8-4-,17-10+ |
| InChIKey | GGALOQZIXKKIBK-YXLBEMIDSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|