C20H25N5O2 — CID 143541615
8-amino-6-(3-imidazol-1-ylpropylamino)-2,2,7-trimethyl-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraen-10-one (PubChem CID 143541615) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 8-amino-6-(3-imidazol-1-ylpropylamino)-2,2,7-trimethyl-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraen-10-one.
| Compound Name | 8-amino-6-(3-imidazol-1-ylpropylamino)-2,2,7-trimethyl-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraen-10-one |
|---|---|
| PubChem CID | 143541615 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 8-amino-6-(3-imidazol-1-ylpropylamino)-2,2,7-trimethyl-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraen-10-one |
| SMILES | Cc1c(NCCCn2ccnc2)c2c3c(c1N)c(=O)ccn3C(C)(C)CO2 |
| InChI | InChI=1S/C20H25N5O2/c1-13-16(21)15-14(26)5-9-25-18(15)19(27-11-20(25,2)3)17(13)23-6-4-8-24-10-7-22-12-24/h5,7,9-10,12,23H,4,6,8,11,21H2,1-3H3 |
| InChIKey | LGVAABIXLYVPDE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|