C19H24N2OS — CID 143542444
N-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methyl-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 143542444) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is N-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methyl-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | N-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methyl-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 143542444 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methyl-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | CCc1ccc(OC)c(SNc2cccc3c2CN(C)CC3)c1 |
| InChI | InChI=1S/C19H24N2OS/c1-4-14-8-9-18(22-3)19(12-14)23-20-17-7-5-6-15-10-11-21(2)13-16(15)17/h5-9,12,20H,4,10-11,13H2,1-3H3 |
| InChIKey | QTWKBAONSIBLDF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|