C53H52F6N6O6S2 — CID 143542743
N,N'-bis[2-methyl-5-[(4-methylsulfanylphenyl)methylcarbamoyl]-6-oxo-1-[3-(trifluoromethyl)phenyl]-3-pyridinyl]nonanediamide (PubChem CID 143542743) has the molecular formula C53H52F6N6O6S2 and a molecular weight of 1047.16 g/mol. Its IUPAC name is N,N'-bis[2-methyl-5-[(4-methylsulfanylphenyl)methylcarbamoyl]-6-oxo-1-[3-(trifluoromethyl)phenyl]-3-pyridinyl]nonanediamide.
| Compound Name | N,N'-bis[2-methyl-5-[(4-methylsulfanylphenyl)methylcarbamoyl]-6-oxo-1-[3-(trifluoromethyl)phenyl]-3-pyridinyl]nonanediamide |
|---|---|
| PubChem CID | 143542743 |
| Molecular Formula | C53H52F6N6O6S2 |
| Molecular Weight | 1047.16 g/mol |
| Exact Mass | 1046.33 |
| IUPAC Name | N,N'-bis[2-methyl-5-[(4-methylsulfanylphenyl)methylcarbamoyl]-6-oxo-1-[3-(trifluoromethyl)phenyl]-3-pyridinyl]nonanediamide |
| SMILES | CSc1ccc(CNC(=O)c2cc(NC(=O)CCCCCCCC(=O)Nc3cc(C(=O)NCc4ccc(SC)cc4)c(=O)n(-c4cccc(C(F)(F)F)c4)c3C)c(C)n(-c3cccc(C(F)(F)F)c3)c2=O)cc1 |
| InChI | InChI=1S/C53H52F6N6O6S2/c1-32-44(28-42(48(68)60-30-34-18-22-40(72-3)23-19-34)50(70)64(32)38-14-10-12-36(26-38)52(54,55)56)62-46(66)16-8-6-5-7-9-17-47(67)63-45-29-43(49(69)61-31-35-20-24-41(73-4)25-21-35)51(71)65(33(45)2)39-15-11-13-37(27-39)53(57,58)59/h10-15,18-29H,5-9,16-17,30-31H2,1-4H3,(H,60,68)(H,61,69)(H,62,66)(H,63,67) |
| InChIKey | IKQOBPIZLZLASH-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 160.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.16 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|