C21H23N5O3 — CID 143546241
tert-butyl N-[4-(4-carbamoyl-5-phenyl-1H-pyrrol-2-yl)pyrimidin-2-yl]-N-methylcarbamate (PubChem CID 143546241) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is tert-butyl N-[4-(4-carbamoyl-5-phenyl-1H-pyrrol-2-yl)pyrimidin-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-(4-carbamoyl-5-phenyl-1H-pyrrol-2-yl)pyrimidin-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 143546241 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | tert-butyl N-[4-(4-carbamoyl-5-phenyl-1H-pyrrol-2-yl)pyrimidin-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1nccc(-c2cc(C(N)=O)c(-c3ccccc3)[nH]2)n1 |
| InChI | InChI=1S/C21H23N5O3/c1-21(2,3)29-20(28)26(4)19-23-11-10-15(25-19)16-12-14(18(22)27)17(24-16)13-8-6-5-7-9-13/h5-12,24H,1-4H3,(H2,22,27) |
| InChIKey | BGKCGJODUACSEH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |