C40H41N4S2+ — CID 143546600
2-[(1E,3E,5Z)-5-(6-methyliminocyclohexa-2,4-dien-1-ylidene)penta-1,3-dienyl]-N-[2-[2-[2-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline (PubChem CID 143546600) has the molecular formula C40H41N4S2+ and a molecular weight of 641.93 g/mol. Its IUPAC name is 2-[(1E,3E,5Z)-5-(6-methyliminocyclohexa-2,4-dien-1-ylidene)penta-1,3-dienyl]-N-[2-[2-[2-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline.
| Compound Name | 2-[(1E,3E,5Z)-5-(6-methyliminocyclohexa-2,4-dien-1-ylidene)penta-1,3-dienyl]-N-[2-[2-[2-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline |
|---|---|
| PubChem CID | 143546600 |
| Molecular Formula | C40H41N4S2+ |
| Molecular Weight | 641.93 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 2-[(1E,3E,5Z)-5-(6-methyliminocyclohexa-2,4-dien-1-ylidene)penta-1,3-dienyl]-N-[2-[2-[2-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline |
| SMILES | C/N=C1\C=CC=C\C1=C\C=C\C=C\c1ccccc1NCCSSCCNc1ccccc1/C=C/c1ccc2ccccc2[n+]1C |
| InChI | InChI=1S/C40H40N4S2/c1-41-37-20-10-6-16-32(37)14-4-3-5-15-33-17-7-11-21-38(33)42-28-30-45-46-31-29-43-39-22-12-8-18-34(39)24-26-36-27-25-35-19-9-13-23-40(35)44(36)2/h3-27H,28-31H2,1-2H3,(H,41,42)/p+1 |
| InChIKey | YJPVECFWFJHBMV-UHFFFAOYSA-O |
| XLogP | 9.43 |
| TPSA | 40.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.93 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|