C26H32N3OS+ — CID 143546867
4-[(E)-2-[1-[2-[(3-ethyl-6,7-dihydro-2H-1,3-benzoxazol-2-yl)sulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 143546867) has the molecular formula C26H32N3OS+ and a molecular weight of 434.63 g/mol. Its IUPAC name is 4-[(E)-2-[1-[2-[(3-ethyl-6,7-dihydro-2H-1,3-benzoxazol-2-yl)sulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[1-[2-[(3-ethyl-6,7-dihydro-2H-1,3-benzoxazol-2-yl)sulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 143546867 |
| Molecular Formula | C26H32N3OS+ |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 4-[(E)-2-[1-[2-[(3-ethyl-6,7-dihydro-2H-1,3-benzoxazol-2-yl)sulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CCN1C2=C(CCC=C2)OC1SCC[n+]1ccc(/C=C/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H32N3OS/c1-4-29-24-7-5-6-8-25(24)30-26(29)31-20-19-28-17-15-22(16-18-28)10-9-21-11-13-23(14-12-21)27(2)3/h5,7,9-18,26H,4,6,8,19-20H2,1-3H3/q+1 |
| InChIKey | PZLUHNQJVUUQBD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 19.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|