C27H36N6O3 — CID 143548493
N-(4-amino-2-methylphenyl)-N-formylformamide;N-(4-amino-2-methylphenyl)-N-methylformamide;1-N,1-N,2-trimethylbenzene-1,4-diamine (PubChem CID 143548493) has the molecular formula C27H36N6O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is N-(4-amino-2-methylphenyl)-N-formylformamide;N-(4-amino-2-methylphenyl)-N-methylformamide;1-N,1-N,2-trimethylbenzene-1,4-diamine.
| Compound Name | N-(4-amino-2-methylphenyl)-N-formylformamide;N-(4-amino-2-methylphenyl)-N-methylformamide;1-N,1-N,2-trimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143548493 |
| Molecular Formula | C27H36N6O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | N-(4-amino-2-methylphenyl)-N-formylformamide;N-(4-amino-2-methylphenyl)-N-methylformamide;1-N,1-N,2-trimethylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)ccc1N(C)C.Cc1cc(N)ccc1N(C)C=O.Cc1cc(N)ccc1N(C=O)C=O |
| InChI | InChI=1S/C9H10N2O2.C9H12N2O.C9H14N2/c1-7-4-8(10)2-3-9(7)11(5-12)6-13;1-7-5-8(10)3-4-9(7)11(2)6-12;1-7-6-8(10)4-5-9(7)11(2)3/h2-6H,10H2,1H3;3-6H,10H2,1-2H3;4-6H,10H2,1-3H3 |
| InChIKey | RWANUGJFXVEBSN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 138.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|