C24H27F2N7O2 — CID 143548940
tert-butyl (3aS)-5-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 143548940) has the molecular formula C24H27F2N7O2 and a molecular weight of 483.52 g/mol. Its IUPAC name is tert-butyl (3aS)-5-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS)-5-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 143548940 |
| Molecular Formula | C24H27F2N7O2 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | tert-butyl (3aS)-5-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(c3cnc(N)c(-c4nnnn4-c4cccc(F)c4F)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C24H27F2N7O2/c1-24(2,3)35-23(34)32-11-15-7-13(8-16(15)12-32)14-9-17(21(27)28-10-14)22-29-30-31-33(22)19-6-4-5-18(25)20(19)26/h4-6,9-10,13,15-16H,7-8,11-12H2,1-3H3,(H2,27,28)/t13?,15-,16?/m1/s1 |
| InChIKey | YWUACDRPARYZSA-OGVSOVDVSA-N |
| XLogP | 3.95 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |