C16H22O3 — CID 14355010
2-methoxy-5-methyl-3-(6-methylhept-5-en-2-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 14355010) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-methoxy-5-methyl-3-(6-methylhept-5-en-2-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methoxy-5-methyl-3-(6-methylhept-5-en-2-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 14355010 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-methoxy-5-methyl-3-(6-methylhept-5-en-2-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(C(C)CCC=C(C)C)C(=O)C(C)=CC1=O |
| InChI | InChI=1S/C16H22O3/c1-10(2)7-6-8-11(3)14-15(18)12(4)9-13(17)16(14)19-5/h7,9,11H,6,8H2,1-5H3 |
| InChIKey | WRSVRYARVFLNDP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|