C20H39N3O2 — CID 143550150
cis-(1R,2R)-1-(2-methoxypropyl)-1,2-dimethylcyclohexane;ethanamine;1-formylpyrrolidine-2-carbonitrile (PubChem CID 143550150) has the molecular formula C20H39N3O2 and a molecular weight of 353.55 g/mol. Its IUPAC name is cis-(1R,2R)-1-(2-methoxypropyl)-1,2-dimethylcyclohexane;ethanamine;1-formylpyrrolidine-2-carbonitrile.
| Compound Name | cis-(1R,2R)-1-(2-methoxypropyl)-1,2-dimethylcyclohexane;ethanamine;1-formylpyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 143550150 |
| Molecular Formula | C20H39N3O2 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.30 |
| IUPAC Name | cis-(1R,2R)-1-(2-methoxypropyl)-1,2-dimethylcyclohexane;ethanamine;1-formylpyrrolidine-2-carbonitrile |
| SMILES | CCN.COC(C)C[C@@]1(C)CCCC[C@H]1C.N#CC1CCCN1C=O |
| InChI | InChI=1S/C12H24O.C6H8N2O.C2H7N/c1-10-7-5-6-8-12(10,3)9-11(2)13-4;7-4-6-2-1-3-8(6)5-9;1-2-3/h10-11H,5-9H2,1-4H3;5-6H,1-3H2;2-3H2,1H3/t10-,11?,12-;;/m1../s1 |
| InChIKey | ZLIYPHJDEWMXHT-JXIQBYSYSA-N |
| XLogP | 3.72 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|