C22H35N3O2 — CID 143550207
(2S)-1-[2-[[(3aR,6aS)-5-cyclohexyl-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]methylamino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 143550207) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is (2S)-1-[2-[[(3aR,6aS)-5-cyclohexyl-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]methylamino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[2-[[(3aR,6aS)-5-cyclohexyl-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]methylamino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 143550207 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | (2S)-1-[2-[[(3aR,6aS)-5-cyclohexyl-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]methylamino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNCC1C[C@@H]2CC(O)(C3CCCCC3)C[C@@H]2C1 |
| InChI | InChI=1S/C22H35N3O2/c23-13-20-7-4-8-25(20)21(26)15-24-14-16-9-17-11-22(27,12-18(17)10-16)19-5-2-1-3-6-19/h16-20,24,27H,1-12,14-15H2/t16?,17-,18+,20-,22?/m0/s1 |
| InChIKey | FJCOPDDUVXTTHS-XKIIFPSXSA-N |
| XLogP | 2.84 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |