C9H14FI — CID 143551142
(6R)-2-ethyl-4-fluoro-3,6-dimethyl-1λ3-iodacyclohexa-1,3-diene (PubChem CID 143551142) has the molecular formula C9H14FI and a molecular weight of 268.11 g/mol. Its IUPAC name is (6R)-2-ethyl-4-fluoro-3,6-dimethyl-1λ3-iodacyclohexa-1,3-diene.
| Compound Name | (6R)-2-ethyl-4-fluoro-3,6-dimethyl-1λ3-iodacyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143551142 |
| Molecular Formula | C9H14FI |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | (6R)-2-ethyl-4-fluoro-3,6-dimethyl-1λ3-iodacyclohexa-1,3-diene |
| SMILES | CCC1=I[C@H](C)CC(F)=C1C |
| InChI | InChI=1S/C9H14FI/c1-4-9-7(3)8(10)5-6(2)11-9/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | ACFJKOJVPKDZGW-ZCFIWIBFSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|