C9H10F3I — CID 102413221
1-iodo-4,5-dimethyl-2-(trifluoromethyl)cyclohexa-1,4-diene (PubChem CID 102413221) has the molecular formula C9H10F3I and a molecular weight of 302.08 g/mol. Its IUPAC name is 1-iodo-4,5-dimethyl-2-(trifluoromethyl)cyclohexa-1,4-diene.
| Compound Name | 1-iodo-4,5-dimethyl-2-(trifluoromethyl)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 102413221 |
| Molecular Formula | C9H10F3I |
| Molecular Weight | 302.08 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 1-iodo-4,5-dimethyl-2-(trifluoromethyl)cyclohexa-1,4-diene |
| SMILES | CC1=C(C)CC(C(F)(F)F)=C(I)C1 |
| InChI | InChI=1S/C9H10F3I/c1-5-3-7(9(10,11)12)8(13)4-6(5)2/h3-4H2,1-2H3 |
| InChIKey | KZMQACQBQRKFFM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.08 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|