C21H32FN3O3 — CID 143554302
ethane;N-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-propan-2-ylidene-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 143554302) has the molecular formula C21H32FN3O3 and a molecular weight of 393.50 g/mol. Its IUPAC name is ethane;N-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-propan-2-ylidene-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | ethane;N-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-propan-2-ylidene-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 143554302 |
| Molecular Formula | C21H32FN3O3 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | ethane;N-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-propan-2-ylidene-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC.CC(=O)NCC1CN(c2ccc(N3CCOCC3)c(F)c2)C(=C(C)C)O1 |
| InChI | InChI=1S/C19H26FN3O3.C2H6/c1-13(2)19-23(12-16(26-19)11-21-14(3)24)15-4-5-18(17(20)10-15)22-6-8-25-9-7-22;1-2/h4-5,10,16H,6-9,11-12H2,1-3H3,(H,21,24);1-2H3 |
| InChIKey | WBZXKJPHKIDNRK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|