C24H28N2O6S — CID 143555247
diethyl 6-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-ethylazulene-1,3-dicarboxylate (PubChem CID 143555247) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is diethyl 6-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-ethylazulene-1,3-dicarboxylate.
| Compound Name | diethyl 6-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-ethylazulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 143555247 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | diethyl 6-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-ethylazulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c2ccc(N3C[C@H](CNC(C)=S)OC3=O)ccc-2c(C(=O)OCC)c1CC |
| InChI | InChI=1S/C24H28N2O6S/c1-5-17-20(22(27)30-6-2)18-10-8-15(9-11-19(18)21(17)23(28)31-7-3)26-13-16(32-24(26)29)12-25-14(4)33/h8-11,16H,5-7,12-13H2,1-4H3,(H,25,33)/t16-/m0/s1 |
| InChIKey | FYVVETMYPQJHNZ-INIZCTEOSA-N |
| XLogP | 3.97 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|