C25H23F2N3O4S — CID 143555303
ethyl 6-[4-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluoroanilino]azulene-1-carboxylate (PubChem CID 143555303) has the molecular formula C25H23F2N3O4S and a molecular weight of 499.54 g/mol. Its IUPAC name is ethyl 6-[4-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluoroanilino]azulene-1-carboxylate.
| Compound Name | ethyl 6-[4-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluoroanilino]azulene-1-carboxylate |
|---|---|
| PubChem CID | 143555303 |
| Molecular Formula | C25H23F2N3O4S |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | ethyl 6-[4-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluoroanilino]azulene-1-carboxylate |
| SMILES | CCOC(=O)c1ccc2ccc(Nc3c(F)cc(N4C[C@H](CNC(C)=S)OC4=O)cc3F)ccc1-2 |
| InChI | InChI=1S/C25H23F2N3O4S/c1-3-33-24(31)20-8-5-15-4-6-16(7-9-19(15)20)29-23-21(26)10-17(11-22(23)27)30-13-18(34-25(30)32)12-28-14(2)35/h4-11,18,29H,3,12-13H2,1-2H3,(H,28,35)/t18-/m0/s1 |
| InChIKey | ZAULYVSCBNBEJP-SFHVURJKSA-N |
| XLogP | 5.25 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|