C14H27N3 — CID 143556067
(Z)-N,N-dimethyl-2-[4-(methyliminomethyl)piperidin-1-yl]pent-2-en-1-amine (PubChem CID 143556067) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-2-[4-(methyliminomethyl)piperidin-1-yl]pent-2-en-1-amine.
| Compound Name | (Z)-N,N-dimethyl-2-[4-(methyliminomethyl)piperidin-1-yl]pent-2-en-1-amine |
|---|---|
| PubChem CID | 143556067 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (Z)-N,N-dimethyl-2-[4-(methyliminomethyl)piperidin-1-yl]pent-2-en-1-amine |
| SMILES | CC/C=C(/CN(C)C)N1CCC(/C=N/C)CC1 |
| InChI | InChI=1S/C14H27N3/c1-5-6-14(12-16(3)4)17-9-7-13(8-10-17)11-15-2/h6,11,13H,5,7-10,12H2,1-4H3/b14-6-,15-11+ |
| InChIKey | ZPBNQQMBGIVWCY-SZNLFEMRSA-N |
| XLogP | 2.25 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|