C15H27N3 — CID 145197854
N,N-dimethyl-2-(3-methylidene-4-pent-2-en-2-yliminopiperidin-1-yl)ethanamine (PubChem CID 145197854) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-methylidene-4-pent-2-en-2-yliminopiperidin-1-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(3-methylidene-4-pent-2-en-2-yliminopiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 145197854 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N,N-dimethyl-2-(3-methylidene-4-pent-2-en-2-yliminopiperidin-1-yl)ethanamine |
| SMILES | C=C1CN(CCN(C)C)CC/C1=N\C(C)=CCC |
| InChI | InChI=1S/C15H27N3/c1-6-7-14(3)16-15-8-9-18(12-13(15)2)11-10-17(4)5/h7H,2,6,8-12H2,1,3-5H3/b14-7?,16-15+ |
| InChIKey | YDCYYEXEEOVHGD-VPIFSXQUSA-N |
| XLogP | 2.56 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|