C23H31FN6 — CID 143556393
6-(6-fluoro-4-methyl-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]-1,5-dihydro-1,3-diazepin-2-imine (PubChem CID 143556393) has the molecular formula C23H31FN6 and a molecular weight of 410.54 g/mol. Its IUPAC name is 6-(6-fluoro-4-methyl-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]-1,5-dihydro-1,3-diazepin-2-imine.
| Compound Name | 6-(6-fluoro-4-methyl-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]-1,5-dihydro-1,3-diazepin-2-imine |
|---|---|
| PubChem CID | 143556393 |
| Molecular Formula | C23H31FN6 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 6-(6-fluoro-4-methyl-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]-1,5-dihydro-1,3-diazepin-2-imine |
| SMILES | CC1=N/C(=N\CCCC2CCN(C)CC2)NC=C(c2nc3c(C)cc(F)cc3[nH]2)C1 |
| InChI | InChI=1S/C23H31FN6/c1-15-11-19(24)13-20-21(15)29-22(28-20)18-12-16(2)27-23(26-14-18)25-8-4-5-17-6-9-30(3)10-7-17/h11,13-14,17H,4-10,12H2,1-3H3,(H,25,26)(H,28,29) |
| InChIKey | HLZGZBQXANOGIV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|