C18H19BrN2O3 — CID 143557460
methyl 5-bromo-2-[(4-methoxyphenyl)methyl]-5-methyl-4H-indazole-7-carboxylate (PubChem CID 143557460) has the molecular formula C18H19BrN2O3 and a molecular weight of 391.27 g/mol. Its IUPAC name is methyl 5-bromo-2-[(4-methoxyphenyl)methyl]-5-methyl-4H-indazole-7-carboxylate.
| Compound Name | methyl 5-bromo-2-[(4-methoxyphenyl)methyl]-5-methyl-4H-indazole-7-carboxylate |
|---|---|
| PubChem CID | 143557460 |
| Molecular Formula | C18H19BrN2O3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | methyl 5-bromo-2-[(4-methoxyphenyl)methyl]-5-methyl-4H-indazole-7-carboxylate |
| SMILES | COC(=O)C1=CC(C)(Br)Cc2cn(Cc3ccc(OC)cc3)nc21 |
| InChI | InChI=1S/C18H19BrN2O3/c1-18(19)8-13-11-21(10-12-4-6-14(23-2)7-5-12)20-16(13)15(9-18)17(22)24-3/h4-7,9,11H,8,10H2,1-3H3 |
| InChIKey | PVRYCLUYIVSOEJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|