C27H32N6O3 — CID 143559140
N-[1-[3-(aminodiazenyl)-3-iminopropyl]-2-tert-butylindol-5-yl]-1-(4H-1,3-benzodioxin-7-yl)cyclopropane-1-carboxamide (PubChem CID 143559140) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[1-[3-(aminodiazenyl)-3-iminopropyl]-2-tert-butylindol-5-yl]-1-(4H-1,3-benzodioxin-7-yl)cyclopropane-1-carboxamide.
| Compound Name | N-[1-[3-(aminodiazenyl)-3-iminopropyl]-2-tert-butylindol-5-yl]-1-(4H-1,3-benzodioxin-7-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143559140 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | N-[1-[3-(aminodiazenyl)-3-iminopropyl]-2-tert-butylindol-5-yl]-1-(4H-1,3-benzodioxin-7-yl)cyclopropane-1-carboxamide |
| SMILES | [H]/N=C(CCn1c(C(C)(C)C)cc2cc(NC(=O)C3(c4ccc5c(c4)OCOC5)CC3)ccc21)\N=N\N |
| InChI | InChI=1S/C27H32N6O3/c1-26(2,3)23-13-18-12-20(6-7-21(18)33(23)11-8-24(28)31-32-29)30-25(34)27(9-10-27)19-5-4-17-15-35-16-36-22(17)14-19/h4-7,12-14H,8-11,15-16H2,1-3H3,(H,30,34)(H3,28,29,31) |
| InChIKey | DQOJFGKKARFBLD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|