C28H37N3O3 — CID 163824147
N-[1-[2-(aminomethyl)-2-methylbutyl]-2-tert-butylindol-5-yl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide (PubChem CID 163824147) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[1-[2-(aminomethyl)-2-methylbutyl]-2-tert-butylindol-5-yl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[1-[2-(aminomethyl)-2-methylbutyl]-2-tert-butylindol-5-yl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 163824147 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[1-[2-(aminomethyl)-2-methylbutyl]-2-tert-butylindol-5-yl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide |
| SMILES | CCC(C)(CN)Cn1c(C(C)(C)C)cc2cc(NC(=O)C3(c4ccc(O)c(O)c4)CC3)ccc21 |
| InChI | InChI=1S/C28H37N3O3/c1-6-27(5,16-29)17-31-21-9-8-20(13-18(21)14-24(31)26(2,3)4)30-25(34)28(11-12-28)19-7-10-22(32)23(33)15-19/h7-10,13-15,32-33H,6,11-12,16-17,29H2,1-5H3,(H,30,34) |
| InChIKey | NXYXKKPCVREQAR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|