C27H33BN2O4 — CID 89328997
CID 89328997 (PubChem CID 89328997) has the molecular formula C27H33BN2O4 and a molecular weight of 460.38 g/mol.
| Compound Name | CID 89328997 |
|---|---|
| PubChem CID | 89328997 |
| Molecular Formula | C27H33BN2O4 |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | — |
| SMILES | [B]C[C@@H](COC)Cn1c(C(C)(C)C)cc2cc(NC(=O)C3(c4ccc(O)c(O)c4)CC3)ccc21 |
| InChI | InChI=1S/C27H33BN2O4/c1-26(2,3)24-12-18-11-20(6-7-21(18)30(24)15-17(14-28)16-34-4)29-25(33)27(9-10-27)19-5-8-22(31)23(32)13-19/h5-8,11-13,17,31-32H,9-10,14-16H2,1-4H3,(H,29,33)/t17-/m1/s1 |
| InChIKey | NHMCUWGVXIBYBR-QGZVFWFLSA-N |
| XLogP | 4.87 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|