C34H22F6N6S2 — CID 143560686
bis[6-[4-(trifluoromethyl)phenyl]pyridine-2-carboximidoyl] benzene-1,3-dicarboximidothioate (PubChem CID 143560686) has the molecular formula C34H22F6N6S2 and a molecular weight of 692.71 g/mol. Its IUPAC name is bis[6-[4-(trifluoromethyl)phenyl]pyridine-2-carboximidoyl] benzene-1,3-dicarboximidothioate.
| Compound Name | bis[6-[4-(trifluoromethyl)phenyl]pyridine-2-carboximidoyl] benzene-1,3-dicarboximidothioate |
|---|---|
| PubChem CID | 143560686 |
| Molecular Formula | C34H22F6N6S2 |
| Molecular Weight | 692.71 g/mol |
| Exact Mass | 692.13 |
| IUPAC Name | bis[6-[4-(trifluoromethyl)phenyl]pyridine-2-carboximidoyl] benzene-1,3-dicarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1cccc(-c2ccc(C(F)(F)F)cc2)n1)c1cccc(/C(=N\[H])S/C(=N\[H])c2cccc(-c3ccc(C(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C34H22F6N6S2/c35-33(36,37)23-14-10-19(11-15-23)25-6-2-8-27(45-25)31(43)47-29(41)21-4-1-5-22(18-21)30(42)48-32(44)28-9-3-7-26(46-28)20-12-16-24(17-13-20)34(38,39)40/h1-18,41-44H/b41-29-,42-30+,43-31+,44-32- |
| InChIKey | BHVDHYBIUJPOMD-ZJSGPRSNSA-N |
| XLogP | 10.02 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.71 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|