C40H24F6N8S2 — CID 143560783
bis[6-[2-(trifluoromethyl)phenyl]pyridine-2-carboximidoyl] 1,10-phenanthroline-2,9-dicarboximidothioate (PubChem CID 143560783) has the molecular formula C40H24F6N8S2 and a molecular weight of 794.81 g/mol. Its IUPAC name is bis[6-[2-(trifluoromethyl)phenyl]pyridine-2-carboximidoyl] 1,10-phenanthroline-2,9-dicarboximidothioate.
| Compound Name | bis[6-[2-(trifluoromethyl)phenyl]pyridine-2-carboximidoyl] 1,10-phenanthroline-2,9-dicarboximidothioate |
|---|---|
| PubChem CID | 143560783 |
| Molecular Formula | C40H24F6N8S2 |
| Molecular Weight | 794.81 g/mol |
| Exact Mass | 794.15 |
| IUPAC Name | bis[6-[2-(trifluoromethyl)phenyl]pyridine-2-carboximidoyl] 1,10-phenanthroline-2,9-dicarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1cccc(-c2ccccc2C(F)(F)F)n1)c1ccc2ccc3ccc(/C(=N/[H])S/C(=N/[H])c4cccc(-c5ccccc5C(F)(F)F)n4)nc3c2n1 |
| InChI | InChI=1S/C40H24F6N8S2/c41-39(42,43)25-9-3-1-7-23(25)27-11-5-13-29(51-27)35(47)55-37(49)31-19-17-21-15-16-22-18-20-32(54-34(22)33(21)53-31)38(50)56-36(48)30-14-6-12-28(52-30)24-8-2-4-10-26(24)40(44,45)46/h1-20,47-50H/b47-35+,48-36+,49-37-,50-38- |
| InChIKey | NBGXUPOMSOMRAJ-XZFKBADVSA-N |
| XLogP | 11.11 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.81 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|