C30H22N8S2 — CID 89222002
bis(6-pyridin-2-ylpyridine-2-carboximidoyl) benzene-1,4-dicarboximidothioate (PubChem CID 89222002) has the molecular formula C30H22N8S2 and a molecular weight of 558.70 g/mol. Its IUPAC name is bis(6-pyridin-2-ylpyridine-2-carboximidoyl) benzene-1,4-dicarboximidothioate.
| Compound Name | bis(6-pyridin-2-ylpyridine-2-carboximidoyl) benzene-1,4-dicarboximidothioate |
|---|---|
| PubChem CID | 89222002 |
| Molecular Formula | C30H22N8S2 |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | bis(6-pyridin-2-ylpyridine-2-carboximidoyl) benzene-1,4-dicarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1cccc(-c2ccccn2)n1)c1ccc(/C(=N\[H])S/C(=N\[H])c2cccc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C30H22N8S2/c31-27(39-29(33)25-11-5-9-23(37-25)21-7-1-3-17-35-21)19-13-15-20(16-14-19)28(32)40-30(34)26-12-6-10-24(38-26)22-8-2-4-18-36-22/h1-18,31-34H/b31-27-,32-28+,33-29+,34-30- |
| InChIKey | SFQDTWRCKYIKML-SURSKDNRSA-N |
| XLogP | 6.77 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|