C49H36N10S2 — CID 143560751
bis[6-(6-pyridin-2-yl-2-pyridinyl)pyridine-2-carboximidoyl] 9,9-dimethylfluorene-2,7-dicarboximidothioate (PubChem CID 143560751) has the molecular formula C49H36N10S2 and a molecular weight of 829.03 g/mol. Its IUPAC name is bis[6-(6-pyridin-2-yl-2-pyridinyl)pyridine-2-carboximidoyl] 9,9-dimethylfluorene-2,7-dicarboximidothioate.
| Compound Name | bis[6-(6-pyridin-2-yl-2-pyridinyl)pyridine-2-carboximidoyl] 9,9-dimethylfluorene-2,7-dicarboximidothioate |
|---|---|
| PubChem CID | 143560751 |
| Molecular Formula | C49H36N10S2 |
| Molecular Weight | 829.03 g/mol |
| Exact Mass | 828.26 |
| IUPAC Name | bis[6-(6-pyridin-2-yl-2-pyridinyl)pyridine-2-carboximidoyl] 9,9-dimethylfluorene-2,7-dicarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1cccc(-c2cccc(-c3ccccn3)n2)n1)c1ccc2c(c1)C(C)(C)c1cc(/C(=N/[H])S/C(=N/[H])c3cccc(-c4cccc(-c5ccccn5)n4)n3)ccc1-2 |
| InChI | InChI=1S/C49H36N10S2/c1-49(2)33-27-29(45(50)60-47(52)43-19-9-17-41(58-43)39-15-7-13-37(56-39)35-11-3-5-25-54-35)21-23-31(33)32-24-22-30(28-34(32)49)46(51)61-48(53)44-20-10-18-42(59-44)40-16-8-14-38(57-40)36-12-4-6-26-55-36/h3-28,50-53H,1-2H3/b50-45-,51-46-,52-47+,53-48+ |
| InChIKey | LNLIEAZSJJYUTM-GJZHTXNZSA-N |
| XLogP | 11.20 |
| TPSA | 172.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.03 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|