C44H28N5S2+ — CID 163687580
[7-[4-(6-naphthalen-1-yl-2-pyridinyl)-1-thia-3-azoniacyclobuta-2,3-dien-2-yl]naphthalene-2-carboximidoyl] 6-naphthalen-1-ylpyridine-2-carboximidothioate (PubChem CID 163687580) has the molecular formula C44H28N5S2+ and a molecular weight of 690.88 g/mol. Its IUPAC name is [7-[4-(6-naphthalen-1-yl-2-pyridinyl)-1-thia-3-azoniacyclobuta-2,3-dien-2-yl]naphthalene-2-carboximidoyl] 6-naphthalen-1-ylpyridine-2-carboximidothioate.
| Compound Name | [7-[4-(6-naphthalen-1-yl-2-pyridinyl)-1-thia-3-azoniacyclobuta-2,3-dien-2-yl]naphthalene-2-carboximidoyl] 6-naphthalen-1-ylpyridine-2-carboximidothioate |
|---|---|
| PubChem CID | 163687580 |
| Molecular Formula | C44H28N5S2+ |
| Molecular Weight | 690.88 g/mol |
| Exact Mass | 690.18 |
| IUPAC Name | [7-[4-(6-naphthalen-1-yl-2-pyridinyl)-1-thia-3-azoniacyclobuta-2,3-dien-2-yl]naphthalene-2-carboximidoyl] 6-naphthalen-1-ylpyridine-2-carboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1cccc(-c2cccc3ccccc23)n1)c1ccc2ccc(C3=[N+]=C(c4cccc(-c5cccc6ccccc56)n4)S3)cc2c1 |
| InChI | InChI=1S/C44H28N5S2/c45-41(50-42(46)39-19-7-17-37(47-39)35-15-5-11-28-9-1-3-13-33(28)35)30-23-21-27-22-24-31(26-32(27)25-30)43-49-44(51-43)40-20-8-18-38(48-40)36-16-6-12-29-10-2-4-14-34(29)36/h1-26,45-46H/q+1/b45-41-,46-42+ |
| InChIKey | JQEDZVFAOLRDFD-WLVHBXHQSA-N |
| XLogP | 10.36 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.88 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|