C50H40N6S2 — CID 89222018
bis[6-(9,9-dimethylfluoren-2-yl)pyridine-2-carboximidoyl] benzene-1,4-dicarboximidothioate (PubChem CID 89222018) has the molecular formula C50H40N6S2 and a molecular weight of 789.05 g/mol. Its IUPAC name is bis[6-(9,9-dimethylfluoren-2-yl)pyridine-2-carboximidoyl] benzene-1,4-dicarboximidothioate.
| Compound Name | bis[6-(9,9-dimethylfluoren-2-yl)pyridine-2-carboximidoyl] benzene-1,4-dicarboximidothioate |
|---|---|
| PubChem CID | 89222018 |
| Molecular Formula | C50H40N6S2 |
| Molecular Weight | 789.05 g/mol |
| Exact Mass | 788.28 |
| IUPAC Name | bis[6-(9,9-dimethylfluoren-2-yl)pyridine-2-carboximidoyl] benzene-1,4-dicarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1cccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)n1)c1ccc(/C(=N\[H])S/C(=N\[H])c2cccc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)n2)cc1 |
| InChI | InChI=1S/C50H40N6S2/c1-49(2)37-13-7-5-11-33(37)35-25-23-31(27-39(35)49)41-15-9-17-43(55-41)47(53)57-45(51)29-19-21-30(22-20-29)46(52)58-48(54)44-18-10-16-42(56-44)32-24-26-36-34-12-6-8-14-38(34)50(3,4)40(36)28-32/h5-28,51-54H,1-4H3/b51-45-,52-46+,53-47+,54-48- |
| InChIKey | IONREXHECDPIOA-XGFAFHFTSA-N |
| XLogP | 12.59 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.05 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|