About 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide
2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide (PubChem CID 143561250) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide.
Molecular Properties
| Compound Name | 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide |
| PubChem CID | 143561250 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide |
| SMILES | CN(C)C(=O)C(C)(C)c1ccc(CNC=O)cc1 |
| InChI | InChI=1S/C14H20N2O2/c1-14(2,13(18)16(3)4)12-7-5-11(6-8-12)9-15-10-17/h5-8,10H,9H2,1-4H3,(H,15,17) |
| InChIKey | QAVBAYOWUODVOB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide?
The IUPAC name of 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide (CID 143561250) is 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide.
What is the SMILES notation for 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide?
The canonical SMILES for 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide is CN(C)C(=O)C(C)(C)c1ccc(CNC=O)cc1.
What is the InChIKey of 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide?
The InChIKey is QAVBAYOWUODVOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-14(2,13(18)16(3)4)12-7-5-11(6-8-12)9-15-10-17/h5-8,10H,9H2,1-4H3,(H,15,17).
What are the key properties of 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide?
2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide has a molecular weight of 248.33 g/mol, XLogP of 1.30, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(formamidomethyl)phenyl]-N,N,2-trimethylpropanamide is sourced from PubChem (CID 143561250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).