C29H35F5N6 — CID 143562703
6-(2,3-difluorophenyl)-2-methylidene-1-(2,2,2-trifluoroethyl)azepane;1-[4-(2-methylidene-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]ethenamine (PubChem CID 143562703) has the molecular formula C29H35F5N6 and a molecular weight of 562.63 g/mol. Its IUPAC name is 6-(2,3-difluorophenyl)-2-methylidene-1-(2,2,2-trifluoroethyl)azepane;1-[4-(2-methylidene-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]ethenamine.
| Compound Name | 6-(2,3-difluorophenyl)-2-methylidene-1-(2,2,2-trifluoroethyl)azepane;1-[4-(2-methylidene-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]ethenamine |
|---|---|
| PubChem CID | 143562703 |
| Molecular Formula | C29H35F5N6 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 6-(2,3-difluorophenyl)-2-methylidene-1-(2,2,2-trifluoroethyl)azepane;1-[4-(2-methylidene-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]ethenamine |
| SMILES | C=C(N)N1CCC(N2C(=C)Nc3ncccc32)CC1.C=C1CCCC(c2cccc(F)c2F)CN1CC(F)(F)F |
| InChI | InChI=1S/C15H16F5N.C14H19N5/c1-10-4-2-5-11(8-21(10)9-15(18,19)20)12-6-3-7-13(16)14(12)17;1-10(15)18-8-5-12(6-9-18)19-11(2)17-14-13(19)4-3-7-16-14/h3,6-7,11H,1-2,4-5,8-9H2;3-4,7,12H,1-2,5-6,8-9,15H2,(H,16,17) |
| InChIKey | UMJYKZYUULOATH-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |