C12H14F2O — CID 143562734
5-(2,3-difluorophenyl)hexanal (PubChem CID 143562734) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is 5-(2,3-difluorophenyl)hexanal.
| Compound Name | 5-(2,3-difluorophenyl)hexanal |
|---|---|
| PubChem CID | 143562734 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-(2,3-difluorophenyl)hexanal |
| SMILES | CC(CCCC=O)c1cccc(F)c1F |
| InChI | InChI=1S/C12H14F2O/c1-9(5-2-3-8-15)10-6-4-7-11(13)12(10)14/h4,6-9H,2-3,5H2,1H3 |
| InChIKey | LSJDOSRGCNSBFI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|