C22H30N8OS — CID 143563216
5-[[8-cyclopentyl-7-ethyl-5-[(Z)-hydrazinylidenemethyl]-6,7-dihydropteridin-2-yl]amino]-N-cyclopropylthiophene-2-carboxamide (PubChem CID 143563216) has the molecular formula C22H30N8OS and a molecular weight of 454.60 g/mol. Its IUPAC name is 5-[[8-cyclopentyl-7-ethyl-5-[(Z)-hydrazinylidenemethyl]-6,7-dihydropteridin-2-yl]amino]-N-cyclopropylthiophene-2-carboxamide.
| Compound Name | 5-[[8-cyclopentyl-7-ethyl-5-[(Z)-hydrazinylidenemethyl]-6,7-dihydropteridin-2-yl]amino]-N-cyclopropylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 143563216 |
| Molecular Formula | C22H30N8OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 5-[[8-cyclopentyl-7-ethyl-5-[(Z)-hydrazinylidenemethyl]-6,7-dihydropteridin-2-yl]amino]-N-cyclopropylthiophene-2-carboxamide |
| SMILES | CCC1CN(/C=N\N)c2cnc(Nc3ccc(C(=O)NC4CC4)s3)nc2N1C1CCCC1 |
| InChI | InChI=1S/C22H30N8OS/c1-2-15-12-29(13-25-23)17-11-24-22(28-20(17)30(15)16-5-3-4-6-16)27-19-10-9-18(32-19)21(31)26-14-7-8-14/h9-11,13-16H,2-8,12,23H2,1H3,(H,26,31)(H,24,27,28)/b25-13- |
| InChIKey | NWBCBRDQIAUYRC-MXAYSNPKSA-N |
| XLogP | 3.42 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|