C11H18N2 — CID 143564056
1,2,5-trimethyl-6-methylidene-4-propylpyrimidine (PubChem CID 143564056) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1,2,5-trimethyl-6-methylidene-4-propylpyrimidine.
| Compound Name | 1,2,5-trimethyl-6-methylidene-4-propylpyrimidine |
|---|---|
| PubChem CID | 143564056 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1,2,5-trimethyl-6-methylidene-4-propylpyrimidine |
| SMILES | C=C1C(C)=C(CCC)N=C(C)N1C |
| InChI | InChI=1S/C11H18N2/c1-6-7-11-8(2)9(3)13(5)10(4)12-11/h3,6-7H2,1-2,4-5H3 |
| InChIKey | BMNWALWOGPKNHW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |