C19H26N2 — CID 168932717
1-(3-methylbut-1-en-2-yl)-N-[(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]pyridin-2-imine (PubChem CID 168932717) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-(3-methylbut-1-en-2-yl)-N-[(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]pyridin-2-imine.
| Compound Name | 1-(3-methylbut-1-en-2-yl)-N-[(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]pyridin-2-imine |
|---|---|
| PubChem CID | 168932717 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-(3-methylbut-1-en-2-yl)-N-[(3Z)-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]pyridin-2-imine |
| SMILES | C=C/C=C(\C=C/C)CC/N=c1\ccccn1C(=C)C(C)C |
| InChI | InChI=1S/C19H26N2/c1-6-10-18(11-7-2)13-14-20-19-12-8-9-15-21(19)17(5)16(3)4/h6-12,15-16H,1,5,13-14H2,2-4H3/b11-7-,18-10+,20-19+ |
| InChIKey | IGQMTLNDLONQSL-ZRHRPPCXSA-N |
| XLogP | 4.59 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|