C17H22N2 — CID 123319103
N'-(6,6-dimethylbenzo[7]annulen-4-yl)-N,N-dimethylethanimidamide (PubChem CID 123319103) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N'-(6,6-dimethylbenzo[7]annulen-4-yl)-N,N-dimethylethanimidamide.
| Compound Name | N'-(6,6-dimethylbenzo[7]annulen-4-yl)-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 123319103 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N'-(6,6-dimethylbenzo[7]annulen-4-yl)-N,N-dimethylethanimidamide |
| SMILES | C/C(=N\c1cccc2c1=CC(C)(C)C=CC=2)N(C)C |
| InChI | InChI=1S/C17H22N2/c1-13(19(4)5)18-16-10-6-8-14-9-7-11-17(2,3)12-15(14)16/h6-12H,1-5H3/b18-13+ |
| InChIKey | DINNNHMKJLXDCB-QGOAFFKASA-N |
| XLogP | 2.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|