C22H24N2 — CID 142385048
7-[(1Z)-buta-1,3-dienyl]-N'-(1-cyclohexa-1,5-dien-1-ylethenyl)-6-methyl-N-methylidenecyclohepta-1,3,6-triene-1-carboximidamide (PubChem CID 142385048) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 7-[(1Z)-buta-1,3-dienyl]-N'-(1-cyclohexa-1,5-dien-1-ylethenyl)-6-methyl-N-methylidenecyclohepta-1,3,6-triene-1-carboximidamide.
| Compound Name | 7-[(1Z)-buta-1,3-dienyl]-N'-(1-cyclohexa-1,5-dien-1-ylethenyl)-6-methyl-N-methylidenecyclohepta-1,3,6-triene-1-carboximidamide |
|---|---|
| PubChem CID | 142385048 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 7-[(1Z)-buta-1,3-dienyl]-N'-(1-cyclohexa-1,5-dien-1-ylethenyl)-6-methyl-N-methylidenecyclohepta-1,3,6-triene-1-carboximidamide |
| SMILES | C=C/C=C\C1=C(C)CC=CC=C1/C(N=C)=N\C(=C)C1=CCCC=C1 |
| InChI | InChI=1S/C22H24N2/c1-5-6-15-20-17(2)12-10-11-16-21(20)22(23-4)24-18(3)19-13-8-7-9-14-19/h5-6,8,10-11,13-16H,1,3-4,7,9,12H2,2H3/b15-6-,24-22+ |
| InChIKey | SUVVWRLFPPZIPO-NDSHBESESA-N |
| XLogP | 5.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|