C25H20N2O4S — CID 143568632
4-[[3-cyano-4-(4-methoxyphenyl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-pyridinyl]oxymethyl]benzoic acid (PubChem CID 143568632) has the molecular formula C25H20N2O4S and a molecular weight of 444.51 g/mol. Its IUPAC name is 4-[[3-cyano-4-(4-methoxyphenyl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-pyridinyl]oxymethyl]benzoic acid.
| Compound Name | 4-[[3-cyano-4-(4-methoxyphenyl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-pyridinyl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 143568632 |
| Molecular Formula | C25H20N2O4S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-[[3-cyano-4-(4-methoxyphenyl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-pyridinyl]oxymethyl]benzoic acid |
| SMILES | C=C/C=C(\S)c1cc(-c2ccc(OC)cc2)c(C#N)c(OCc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C25H20N2O4S/c1-3-4-23(32)22-13-20(17-9-11-19(30-2)12-10-17)21(14-26)24(27-22)31-15-16-5-7-18(8-6-16)25(28)29/h3-13,32H,1,15H2,2H3,(H,28,29)/b23-4- |
| InChIKey | PZMUEYZGKFHVDP-WVHIBCRRSA-N |
| XLogP | 5.36 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|