C21H15F9N2OS2 — CID 143570358
N-[4-[5-[3,5-bis(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-1,1-bis(methylsulfanyl)methanimine (PubChem CID 143570358) has the molecular formula C21H15F9N2OS2 and a molecular weight of 546.48 g/mol. Its IUPAC name is N-[4-[5-[3,5-bis(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-1,1-bis(methylsulfanyl)methanimine.
| Compound Name | N-[4-[5-[3,5-bis(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-1,1-bis(methylsulfanyl)methanimine |
|---|---|
| PubChem CID | 143570358 |
| Molecular Formula | C21H15F9N2OS2 |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | N-[4-[5-[3,5-bis(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-1,1-bis(methylsulfanyl)methanimine |
| SMILES | CSC(=Nc1ccc(C2=NOC(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)(C(F)(F)F)C2)cc1)SC |
| InChI | InChI=1S/C21H15F9N2OS2/c1-34-17(35-2)31-15-5-3-11(4-6-15)16-10-18(33-32-16,21(28,29)30)12-7-13(19(22,23)24)9-14(8-12)20(25,26)27/h3-9H,10H2,1-2H3 |
| InChIKey | RCHVBVDBGSZPPE-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|